For research use only. Not for therapeutic Use.
Amiloride is a potassium-sparing diuretic widely used in the treatment of hypertension and congestive heart failure. It works by inhibiting sodium reabsorption in the distal convoluted tubules and collecting ducts of the kidneys, reducing fluid retention while preserving potassium levels. Amiloride is also used in combination with other diuretics to prevent hypokalemia. Its ability to block epithelial sodium channels (ENaC) makes it valuable for studying ion transport and related conditions, including cystic fibrosis and Liddle’s syndrome, in medical research.
| Catalog Number | I002891 |
| CAS Number | 2609-46-3 |
| Molecular Formula | C6H8ClN7O |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20 ℃ |
| IUPAC Name | 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide |
| InChI | 1S/C6H8ClN7O/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11/h(H4,8,9,13)(H4,10,11,14,15) |
| InChIKey | XSDQTOBWRPYKKA-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(C(=N1)Cl)N)N)C(=O)N=C(N)N |
