For research use only. Not for therapeutic Use.
Amine-PEG3-Lys(PEG3-N3)-PEG3-N3(CAT: I040923) is a bifunctional compound designed for use in bioconjugation and drug delivery applications. It consists of an amine group, a lysine (Lys) residue, and two PEG3 (polyethylene glycol) spacers, each attached to a azide (N3) group. The PEG3 chains enhance solubility and stability, while the azide groups facilitate click chemistry reactions, such as the copper-catalyzed azide-alkyne cycloaddition (CuAAC), allowing for precise conjugation to other molecules, such as proteins, antibodies, or small drug molecules. This compound is valuable for research in material chemistry and pharmaceutical development, particularly in targeted drug delivery systems and bioconjugation technologies.
CAS Number | 2244602-35-3 |
Synonyms | (2S)-2-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]-6-[[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetyl]amino]-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]hexanamide |
Molecular Formula | C30H58N10O12 |
Purity | ≥95% |
IUPAC Name | (2S)-2-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]-6-[[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetyl]amino]-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]hexanamide |
InChI | InChI=1S/C30H58N10O12/c31-4-9-44-13-17-49-22-24-52-26-29(42)38-27(30(43)35-6-10-45-14-18-48-19-15-46-11-7-36-39-32)3-1-2-5-34-28(41)25-51-23-21-50-20-16-47-12-8-37-40-33/h27H,1-26,31H2,(H,34,41)(H,35,43)(H,38,42)/t27-/m0/s1 |
InChIKey | SJLHOKKVDLXMOO-MHZLTWQESA-N |
SMILES | C(CCNC(=O)COCCOCCOCCN=[N+]=[N-])C[C@@H](C(=O)NCCOCCOCCOCCN=[N+]=[N-])NC(=O)COCCOCCOCCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |