For research use only. Not for therapeutic Use.
Aminomethyltrioxsalen hydrochloride (Cat.No:I022018) is a psoralen compound DNA intercalator used to inactivate DNA and RNA viruses, including HIV-1, by nucleic acid cross-linking followed by UV irradiation.
| Catalog Number | I022018 |
| CAS Number | 62442-61-9 |
| Synonyms | Aminomethyltrioxsalen hydrochloride, Aminomethyltrioxsalen HCl |
| Molecular Formula | C15H16ClNO3 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
| IUPAC Name | 3-(Aminomethyl)-2,5,9-trimethyl-7H-furo(3,2-g)(1)benzopyran-7-one hydrochloride |
| InChI | 1S/C15H15NO3.ClH/c1-7-4-13(17)19-14-8(2)15-11(5-10(7)14)12(6-16)9(3)18-15;/h4-5H,6,16H2,1-3H3;1H |
| InChIKey | HAWQZPVGCLHOBD-UHFFFAOYSA-N |
| SMILES | Cl.CC1=CC(=O)Oc2c(C)c3oc(C)c(CN)c3cc12 |
| Reference | 1: Calvet JP, Pederson T. Heterogeneous nuclear RNA double-stranded regions probed in living HeLa cells by crosslinking with the psoralen derivative aminomethyltrioxsalen. Proc Natl Acad Sci U S A. 1979 Feb;76(2):755-9. PubMed PMID: 284397; PubMed Central PMCID: PMC383041. |
