For research use only. Not for therapeutic Use.
Aminopeptidase-IN-1（Cat No.:I042744）is a selective inhibitor of aminopeptidase enzymes, which are involved in the cleavage of amino acids from the N-terminus of peptides. By inhibiting these enzymes, Aminopeptidase-IN-1 can modulate protein processing and peptide degradation pathways, which are crucial in various physiological processes, including immune response, protein turnover, and the regulation of blood pressure. This compound shows potential in therapeutic areas such as cancer, inflammation, and cardiovascular diseases. Its ability to impact immune system function and peptide metabolism makes it a promising tool for further drug development and disease management.
| CAS Number | 374102-08-6 |
| Synonyms | ethyl 2-amino-7-hydroxy-4-(4-nitrophenyl)-4H-chromene-3-carboxylate |
| Molecular Formula | C18H16N2O6 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-amino-7-hydroxy-4-(4-nitrophenyl)-4H-chromene-3-carboxylate |
| InChI | InChI=1S/C18H16N2O6/c1-2-25-18(22)16-15(10-3-5-11(6-4-10)20(23)24)13-8-7-12(21)9-14(13)26-17(16)19/h3-9,15,21H,2,19H2,1H3 |
| InChIKey | PHTAMBMUQWHXLX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC2=C(C1C3=CC=C(C=C3)[N+](=O)[O-])C=CC(=C2)O)N |
