For research use only. Not for therapeutic Use.
Aminoquinol triphosphate(Cat No.:I022041)is a nucleotide analog composed of an aminoquinol base attached to a triphosphate group. It is primarily studied for its potential in inhibiting specific enzymes and interfering with cellular processes such as DNA replication and repair. Aminoquinol triphosphate has applications in research related to antiviral and anticancer therapies, as its structure allows it to mimic natural nucleotides and disrupt the function of essential enzymes involved in cellular metabolism. Its role in modulating various signaling pathways has made it a topic of interest in the development of targeted therapeutic agents.
CAS Number | 3653-53-0 |
Synonyms | Aminochinol triphosphate, Aminoquinol triphosphate |
Molecular Formula | C26H40Cl2N3O12P3 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 4-N-[7-chloro-2-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-4-yl]-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid |
InChI | InChI=1S/C26H31Cl2N3.3H3O4P/c1-4-31(5-2)16-8-9-19(3)29-26-18-22(14-12-20-10-6-7-11-24(20)28)30-25-17-21(27)13-15-23(25)26;3*1-5(2,3)4/h6-7,10-15,17-19H,4-5,8-9,16H2,1-3H3,(H,29,30);3*(H3,1,2,3,4)/b14-12+;;; |
InChIKey | NHNXMYYNFQHZMQ-XPGLNUPKSA-N |
SMILES | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC(=C1)/C=C/C3=CC=CC=C3Cl)Cl.OP(=O)(O)O.OP(=O)(O)O.OP(=O)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |