For research use only. Not for therapeutic Use.
Amiodarone (Cat.No:I002490) is an antiarrhythmic medication used to treat irregular heartbeats, such as ventricular tachycardia and ventricular fibrillation. It works by slowing down the electrical impulses in the heart, which helps to restore normal heart rhythm. It is administered orally or intravenously and can have serious side effects such as lung toxicity, liver damage, and thyroid dysfunction.
| Catalog Number | I002490 |
| CAS Number | 1951-25-3 |
| Molecular Formula | C25H29I2NO3 |
| Purity | ≥95% |
| Target | Membrane Transporter/Ion Channel |
| Solubility | 10 mM in DMSO |
| Storage | store-20℃ |
| IUPAC Name | (2-butyl-1-benzofuran-3-yl)-[4-[2-(diethylamino)ethoxy]-3,5-diiodophenyl]methanone |
| InChI | InChI=1S/C25H29I2NO3/c1-4-7-11-22-23(18-10-8-9-12-21(18)31-22)24(29)17-15-19(26)25(20(27)16-17)30-14-13-28(5-2)6-3/h8-10,12,15-16H,4-7,11,13-14H2,1-3H3 |
| InChIKey | IYIKLHRQXLHMJQ-UHFFFAOYSA-N |
| SMILES | CCCCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC(=C(C(=C3)I)OCCN(CC)CC)I |
