Amitriptyline-13C3 Hydrochloride is a carbon-13 labeled version of amitriptyline hydrochloride, a tricyclic antidepressant used to treat depression, anxiety, and certain types of pain. The carbon-13 labeling at three positions enhances its utility in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy by providing improved sensitivity and accuracy. This labeled compound is valuable for studying the metabolism, pharmacokinetics, and distribution of amitriptyline. It aids in understanding drug interactions, optimizing therapeutic formulations, and validating analytical methods, contributing to more effective treatments and precise drug analysis in clinical and research settings.
| Catalog Number | R049262 |
| CAS Number | 1329837-86-6 |
| Synonyms | 3-(10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethyl-1-propanamine-13C3 Hydrochloride; Adepril-13C3; Amineurin-13C3; Domical-13C3; Elavil-13C3; Endep-13C3; Euplit-13C3; Laroxyl-13C3; Tryptanol-13C3; Tryptizol-13C3; |
| Molecular Formula | C20H24ClN |
| Purity | 95% |
| Storage | Store at +4C |
| IUPAC Name | 3-(5,6-dihydrodibenzo[2,1-b:2/',1/'-f][7]annulen-11-ylidene)-N,N-di(methyl)propan-1-amine;hydrochloride |
| InChI | InChI=1S/C20H23N.ClH/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;/h3-6,8-12H,7,13-15H2,1-2H3;1H/i1+1,2+1,15+1; |
| InChIKey | KFYRPLNVJVHZGT-DGIKSOBDSA-N |
| SMILES | CN(C)CCC=C1C2=CC=CC=C2CCC3=CC=CC=C31.Cl |
