For research use only. Not for therapeutic Use.
Amitriptyline-d6 hydrochloride（Cat No.:S000353） is a deuterated version of amitriptyline hydrochloride, where six hydrogen atoms are replaced with deuterium. Amitriptyline is a tricyclic antidepressant widely used to treat depression, anxiety disorders, and certain types of pain. The substitution of hydrogen with deuterium in this molecule enhances its chemical stability, facilitating more accurate studies of its pharmacokinetics and metabolic pathways.
| Catalog Number | S000353 |
| CAS Number | 203645-63-0 |
| Molecular Formula | C20H18D6ClN |
| Purity | ≥95% |
| IUPAC Name | 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChI | InChI=1S/C20H23N.ClH/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;/h3-6,8-12H,7,13-15H2,1-2H3;1H/i1D3,2D3; |
| InChIKey | KFYRPLNVJVHZGT-TXHXQZCNSA-N |
| SMILES | CN(C)CCC=C1C2=CC=CC=C2CCC3=CC=CC=C31.Cl |
