Amitrole-13C2,15N2(Cat No.:R050786) is an isotopically labeled version of amitrole, a herbicide known for its use in controlling non-crop weed growth. This compound, enriched with two carbon-13 atoms and two nitrogen-15 atoms, enhances the precision of environmental monitoring and residue analysis. It is particularly useful in tracing the environmental fate of amitrole, assessing its degradation, and studying its impact on ecosystems. The stable isotopic labeling allows for detailed detection and quantification in soil and water samples, providing critical data for regulatory compliance and environmental safety assessments.
Catalog Number | R050786 |
CAS Number | 1346603-92-6 |
Synonyms | 1H-1,2,4-Triazol-5-amine-13C2,15N2; 3-Amino-s-triazole-13C2,15N2; (4H-1,2,4-Triazol-3-yl)amine-13C2,15N2; 1H-1,2,4-Triazolamine-13C2,15N2; 3-Aminotriazole-13C2,15N2; 5-Amino-1,2,4-triazole-13C2,15N2; 5-Amino-1H-1,2,4-?triazole-13C2,15N2; ATA-13C2,15N |
Molecular Formula | C2H4N4 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | (3,5-13C2,1,2-15N2)1H-1,2,4-triazol-5-amine |
InChI | InChI=1S/C2H4N4/c3-2-4-1-5-6-2/h1H,(H3,3,4,5,6)/i1+1,2+1,5+1,6+1 |
InChIKey | KLSJWNVTNUYHDU-MAUGHLKVSA-N |
SMILES | [13CH]1=[15N][15NH][13C](=N1)N |