For research use only. Not for therapeutic Use.
Amlodipine maleate（Cat No.:I005299）, is a calcium channel blocker used in the treatment of hypertension (high blood pressure) and angina (chest pain). It is a combination of amlodipine, a calcium channel antagonist, and maleic acid, which acts as a salt-forming agent. Amlodipine maleate works by blocking the influx of calcium ions into vascular smooth muscle cells, leading to vasodilation and relaxation of the blood vessels.
| Catalog Number | I005299 |
| CAS Number | 88150-47-4 |
| Molecular Formula | C24H29ClN2O9 |
| Purity | ≥95% |
| Target | Calcium Channel |
| Solubility | DMSO: ≥ 32 mg/mL |
| Storage | Room Temperature |
| IUPAC Name | (Z)-but-2-enedioic acid;3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChI | InChI=1S/C20H25ClN2O5.C4H4O4/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;5-3(6)1-2-4(7)8/h5-8,17,23H,4,9-11,22H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | TZNOWAJJWCGILX-BTJKTKAUSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)C)COCCN.C(=CC(=O)O)C(=O)O |
| Reference | <p style=/line-height:25px/> |
