For research use only. Not for therapeutic Use.
Ammonium acetate(Cat No.:R063979), is a white crystalline salt widely utilized in various scientific and industrial applications. It is a versatile compound with roles ranging from analytical chemistry to biochemical processes. In laboratory settings, it is commonly used as a buffer solution in mass spectrometry, helping to control the pH of samples in ionization processes. Additionally, it serves as a reagent in organic synthesis, particularly in reactions involving acetic acid. Its soluble and stable nature makes it valuable in diverse applications, spanning from chemical research to pharmaceuticals, where its controlled properties play a pivotal role in achieving desired outcomes.
CAS Number | 631-61-8 |
Synonyms | Acetic Acid Ammonium Salt; Mindererus’s Spirit; 1BEEM; |
Molecular Formula | C2H7NO2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | azanium;acetate |
InChI | InChI=1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3 |
InChIKey | USFZMSVCRYTOJT-UHFFFAOYSA-N |
SMILES | CC(=O)[O-].[NH4+] |