For research use only. Not for therapeutic Use.
Ammonium succinate(Cat No.:M079393) is the ammonium salt of succinic acid, comprising ammonium ions (NH4+) and succinate ions (C4H4O4^2-). It appears as a white, crystalline solid and is highly soluble in water. This compound is primarily used in the biochemical and pharmaceutical industries due to its role as an intermediate in various chemical syntheses and metabolic processes. Ammonium succinate is often utilized in buffer solutions for biological research, helping to maintain pH stability in experiments. Additionally, it finds applications in food technology as a flavor enhancer and in agriculture as a component of fertilizers.
Catalog Number | M079393 |
CAS Number | 15574-09-1 |
Molecular Formula | C4H12N2O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | diazanium;butanedioate |
InChI | InChI=1S/C4H6O4.2H3N/c5-3(6)1-2-4(7)8;;/h1-2H2,(H,5,6)(H,7,8);2*1H3 |
InChIKey | NHJPVZLSLOHJDM-UHFFFAOYSA-N |
SMILES | C(CC(=O)[O-])C(=O)[O-].[NH4+].[NH4+] |