For research use only. Not for therapeutic Use.
Amorolfine（Cat No.:R065136）is an antifungal agent used primarily in the treatment of nail infections, such as onychomycosis, caused by dermatophytes, yeasts, and molds. It works by inhibiting the synthesis of ergosterol, a key component of fungal cell membranes, thereby disrupting the integrity of the cell membrane and preventing fungal growth. Amorolfine is typically applied topically as a nail lacquer or solution. It is effective against a broad spectrum of fungi and is often preferred due to its localized action, reducing the risk of systemic side effects associated with oral antifungal treatments.
| CAS Number | 67467-83-8 |
| Molecular Formula | C21H36ClNO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,6-dimethyl-4-[2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl]morpholine |
| InChI | InChI=1S/C21H35NO/c1-7-21(5,6)20-10-8-19(9-11-20)12-16(2)13-22-14-17(3)23-18(4)15-22/h8-11,16-18H,7,12-15H2,1-6H3 |
| InChIKey | MQHLMHIZUIDKOO-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC=C(C=C1)CC(C)CN2CC(OC(C2)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
