For research use only. Not for therapeutic Use.
AMOZ (Cat No.:R012567) is a derivative of nitrofurans, primarily used as a marker residue in the detection of nitrofuran antibiotic use in food-producing animals. Known for its antimicrobial properties, nitrofurans like AMOZ were historically employed to treat bacterial infections in veterinary medicine. However, due to concerns over their potential carcinogenic and mutagenic effects, their use has been banned in food production in many regions. AMOZ is widely used in research and regulatory testing to monitor compliance and ensure food safety by detecting illegal antibiotic residues.
| Catalog Number | R012567 |
| CAS Number | 43056-63-9 |
| Synonyms | 3-Amino-5-(4-morpholinylmethyl)-2-oxazolidinone; |
| Molecular Formula | C8H15N3O3 |
| Purity | ≥95% |
| Target | Antibiotic |
| Storage | Room temperature |
| IUPAC Name | 3-amino-5-(morpholin-4-ylmethyl)-1,3-oxazolidin-2-one |
| InChI | InChI=1S/C8H15N3O3/c9-11-6-7(14-8(11)12)5-10-1-3-13-4-2-10/h7H,1-6,9H2 |
| InChIKey | TVHAMVOINIHMEX-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2CN(C(=O)O2)N |
