For research use only. Not for therapeutic Use.
(±)-Amphetamine-d8(Cat No.:M091570) is a deuterated form of Amphetamine, featuring eight deuterium atoms which enhance its stability and precision in pharmacokinetic studies. This modification is essential for detailed research into the drug’s metabolism, absorption, and distribution, particularly in the context of therapeutic monitoring and forensic analysis. Amphetamine-d8 allows scientists to trace the metabolic pathways and potential interactions of Amphetamine with high accuracy, aiding in the development of more effective treatments for disorders such as ADHD and narcolepsy. It also plays a crucial role in legal and clinical toxicology by improving the detectability of the substance in biological samples.
CAS Number | 145225-00-9 |
Molecular Formula | C9H13N |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 1,1,1-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-amine |
InChI | InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/i1D3,2D,3D,4D,5D,6D |
InChIKey | KWTSXDURSIMDCE-JGUCLWPXSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CC(C([2H])([2H])[2H])N)[2H])[2H] |