For research use only. Not for therapeutic Use.
Amsacrine（Cat No.:I003839）, also known as mAMSA, is an antineoplastic agent utilized in cancer treatment. It exerts its therapeutic effects by intercalating into the DNA of tumor cells, disrupting DNA replication and transcription processes. Additionally, amsacrine functions as a topoisomerase II inhibitor, preventing the enzyme from properly managing DNA supercoiling and leading to DNA damage and cell death. The combined actions of DNA intercalation and topoisomerase II inhibition contribute to the cytotoxic effects of amsacrine, making it effective in the treatment of certain types of cancer.
| Catalog Number | I003839 |
| CAS Number | 51264-14-3 |
| Synonyms | N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide |
| Molecular Formula | C21H19N3O3S |
| Purity | ≥95% |
| Target | Topoisomerase |
| Solubility | DMSO: ≤ 9.3 mg/mL |
| Storage | 2-8°C(protect from light) |
| IUPAC Name | N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide |
| InChI | InChI=1S/C21H19N3O3S/c1-27-20-13-14(24-28(2,25)26)11-12-19(20)23-21-15-7-3-5-9-17(15)22-18-10-6-4-8-16(18)21/h3-13,24H,1-2H3,(H,22,23) |
| InChIKey | XCPGHVQEEXUHNC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)NS(=O)(=O)C)NC2=C3C=CC=CC3=NC4=CC=CC=C42 |
| Reference | <p style=/line-height:25px/> |
