For research use only. Not for therapeutic Use.
AN-12-H5 intermediate-1 (Cat No.: I040146) is a chemical compound used in the synthesis of potential therapeutic agents. As an intermediate, it plays a crucial role in the production of more complex molecules, often designed for targeting specific biological pathways. AN-12-H5 intermediate-1 may be involved in drug development aimed at diseases such as cancer, autoimmune disorders, or inflammatory conditions. Its specific structure and reactivity allow for further modification, making it a valuable precursor in the creation of novel, bioactive compounds with therapeutic potential.
CAS Number | 254882-14-9 |
Synonyms | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-hydroxypiperidine-1,2-dicarboxylate |
Molecular Formula | C12H21NO5 |
Purity | ≥95% |
InChI | InChI=1S/C12H21NO5/c1-12(2,3)18-11(16)13-6-5-8(14)7-9(13)10(15)17-4/h8-9,14H,5-7H2,1-4H3/t8-,9-/m0/s1 |
InChIKey | RNMVWSAJMIKMDY-IUCAKERBSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1C(=O)OC)O |
Reference | [1]. AN-12-H5 shows no inhibitory effect on PI4KB activity and only moderate inhibitory effects on PI 3-kinase activity[1]. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |