For research use only. Not for therapeutic Use.
AN7973（Cat No.:I018675）is a novel oxaborole antifungal agent designed to target fungal infections, particularly those caused by Candida and Aspergillus species. It works by inhibiting fungal leucyl-tRNA synthetase, an enzyme essential for protein synthesis, leading to disrupted cellular function and fungal cell death. AN7973’s specificity and effectiveness against resistant strains make it a promising candidate in the treatment of invasive and resistant fungal infections. Its unique mechanism of action offers an alternative to traditional antifungals, addressing the growing need for new therapies in antifungal drug development and infectious disease management.
| Catalog Number | I018675 |
| CAS Number | 1620899-32-2 |
| Molecular Formula | C₁₉H₁₇BClN₃O₃ |
| Purity | ≥95% |
| IUPAC Name | 2-chloro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-4-pyrazol-1-ylbenzamide |
| InChI | InChI=1S/C19H17BClN3O3/c1-19(2)15-7-4-12(10-16(15)20(26)27-19)23-18(25)14-6-5-13(11-17(14)21)24-9-3-8-22-24/h3-11,26H,1-2H3,(H,23,25) |
| InChIKey | JUSVAUWJLCQPHI-UHFFFAOYSA-N |
| SMILES | B1(C2=C(C=CC(=C2)NC(=O)C3=C(C=C(C=C3)N4C=CC=N4)Cl)C(O1)(C)C)O |
| Reference | [1]. 1. Lunde CS, et al. Identification of a potent benzoxaborole drug candidate for treating cryptosporidiosis. Nat Commun. 2019 Jun 27; 10(1):2816. |
