For research use only. Not for therapeutic Use.
Anabaseine-d4 is a deuterated analog of anabaseine, used in advanced pharmaceutical and neurochemical research. Containing four deuterium atoms, this compound provides enhanced stability and precision in metabolic studies and receptor binding assays. Anabaseine-d4 is crucial for investigating the nicotinic acetylcholine receptor and developing new therapeutics for neurological disorders. Its high purity and isotopic labeling ensure reliable and consistent results, making it an essential tool for researchers focusing on neuropharmacology, drug development, and the study of neurodegenerative diseases.
| Catalog Number | R003536 |
| CAS Number | 1020719-05-4 |
| Synonyms | 3,4,5,6-Tetrahydro-2,3’-bipyridine-d4 |
| Molecular Formula | C10H12N2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-(2,3,4,5-tetrahydropyridin-6-yl)pyridine |
| InChI | InChI=1S/C10H12N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8H,1-2,5,7H2/i3D,4D,6D,8D |
| InChIKey | AUBPMADJYNSPOA-AJEVBKBKSA-N |
| SMILES | C1CCN=C(C1)C2=CN=CC=C2 |
