Anabasine dihydrochloride(Cat No.:L015977)is a potent alkaloid salt, primarily used in pharmacological research and neurochemical studies. Derived from the tobacco plant, this compound acts as a nicotinic acetylcholine receptor agonist, making it valuable for exploring receptor interactions and neurological processes. Anabasine dihydrochloride is particularly significant in studies related to addiction, neurotoxicity, and the development of novel therapeutic agents targeting cholinergic systems. Its high purity and consistent quality ensure reliable results in experimental setups, making it a crucial tool for advancing neuroscience research.
Catalog Number | L015977 |
CAS Number | 31945-06-9 |
Molecular Formula | C10H16Cl2N2 |
Purity | 95% |
IUPAC Name | 3-[(2S)-piperidin-2-yl]pyridine;dihydrochloride |
InChI | InChI=1S/C10H14N2.2ClH/c1-2-7-12-10(5-1)9-4-3-6-11-8-9;;/h3-4,6,8,10,12H,1-2,5,7H2;2*1H/t10-;;/m0../s1 |
InChIKey | YVAXNODSVITPGV-XRIOVQLTSA-N |
SMILES | C1CCNC(C1)C2=CN=CC=C2.Cl.Cl |