Anacardic Acid (Cat No.:R060884) is a bioactive compound with multiple properties. It is a potent inhibitor of p300 and p300/CBP-related factor histone acetyltransferases, enzymes involved in gene regulation. Additionally, Anacardic Acid exhibits antibacterial and antimicrobial activities, inhibits prostaglandin synthesis, and acts as an inhibitor of tyrosinase and lipoxygenase enzymes. These diverse activities make it a promising candidate for various applications, including as a therapeutic agent in cancer research, antimicrobial formulations, and cosmetics.
Catalog Number | R060884 |
CAS Number | 16611-84-0 |
Synonyms | 6-Pentadecyl Salicyclic Acid; 1-Hydroxy-2-carboxy-3-pentadecylbenzene Anacardic Acid; 2-Hydroxy-6-pentadecylbenzoic Acid; 22:0-Anacardic Acid; 6-Pentadecyl-2-hydroxybenzoic Acid; 6-Pentadecylsalicylic Acid; Cyclogallipharic acid; Hydrogenated Anacard |
Molecular Formula | C₂₂H₃₆O₃ |
Purity | ≥95% |
Target | Aurora Kinase |
Solubility | >17.5mg/mL in DMSO |
Storage | Store at -20°C |
IUPAC Name | 2-hydroxy-6-pentadecylbenzoic acid |
InChI | InChI=1S/C22H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h15,17-18,23H,2-14,16H2,1H3,(H,24,25) |
InChIKey | ADFWQBGTDJIESE-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCC1=C(C(=CC=C1)O)C(=O)O |