For research use only. Not for therapeutic Use.
Anandamide (also known as AEA or N-arachidonoylethanolamine) is an endocannabinoid, a naturally occurring lipid that acts as a neurotransmitter in the endocannabinoid system. It binds primarily to CB1 receptors in the brain and CB2 receptors in the immune system, influencing processes like mood, pain sensation, appetite, and memory. Anandamide is often referred to as the “bliss molecule” due to its role in promoting feelings of happiness and well-being. It is also involved in neuroprotection and the modulation of stress responses.
| Catalog Number | I010356 |
| CAS Number | 94421-68-8 |
| Synonyms | Arachidonylethanolamide, AEA |
| Molecular Formula | C22H37NO2 |
| Purity | ≥95% |
| IC50 | CB1/CB2 receptor |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)icosa-5,8,11,14-tetraenamide |
| InChI | InChI=1S/C22H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h6-7,9-10,12-13,15-16,24H,2-5,8,11,14,17-21H2,1H3,(H,23,25)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | LGEQQWMQCRIYKG-DOFZRALJSA-N |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)NCCO |
