For research use only. Not for therapeutic Use.
ANAVEX 2-73(CAT: I012826) (also known as blarcamesine) is a small molecule targeting sigma-1 and muscarinic receptors, widely studied in neurodegenerative and neurological disease research. It modulates cellular stress responses, enhances mitochondrial function, and restores neuronal homeostasis, making it particularly valuable for exploring therapeutic strategies for conditions such as Alzheimer’s disease, Parkinson’s disease, and Rett syndrome. By promoting neuroprotection and synaptic plasticity, ANAVEX 2-73 addresses key mechanisms underlying cognitive impairment and neuroinflammation. Its dual-action mechanism and promising efficacy in preclinical and clinical studies position it as a critical tool for advancing research into neurodegenerative disorders and potential disease-modifying treatments.
CAS Number | 195615-84-0 |
Synonyms | Tetrahydro-N,N-dimethyl-2,2-diphenyl-3-furanmethanamine hydrochloride |
Molecular Formula | C19-H23-N-O.Cl-H |
Purity | ≥95% |
Target | Sigma Receptor |
IUPAC Name | 1-(2,2-diphenyloxolan-3-yl)-N,N-dimethylmethanamine;hydrochloride |
InChI | 1S/C19H23NO.ClH/c1-20(2)15-18-13-14-21-19(18,16-9-5-3-6-10-16)17-11-7-4-8-12-17;/h3-12,18H,13-15H2,1-2H3;1H |
InChIKey | FEQOLYDPQKHFTD-UHFFFAOYSA-N |
SMILES | CN(C)CC1CCOC1(C2=CC=CC=C2)C3=CC=CC=C3.Cl |