Androsta-1,4,6-triene-3,17-dione is a synthetic steroid derivative commonly used in pharmaceutical research, particularly in the development of aromatase inhibitors. By inhibiting the enzyme aromatase, it prevents the conversion of androgens to estrogens, making it valuable in treatments for hormone-sensitive conditions such as breast cancer. Its structure features three double bonds in the steroid core at positions 1, 4, and 6, with ketone groups at the 3 and 17 positions, contributing to its role in hormone regulation and cancer therapy.
| Catalog Number | R006318 |
| CAS Number | 633-35-2 |
| Molecular Formula | C19H22O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione |
| InChI | InChI=1S/C19H22O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,7,9,11,14-16H,5-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | DKVSUQWCZQBWCP-QAGGRKNESA-N |
| SMILES | CC12CCC3C(C1CCC2=O)C=CC4=CC(=O)C=CC34C |
