For research use only. Not for therapeutic Use.
Anecortave is a synthetic corticosteroid analog that lacks typical glucocorticoid activity but is known for its anti-angiogenic properties. It was primarily developed for the treatment of age-related macular degeneration (AMD), where it works by inhibiting the formation of new blood vessels in the retina, a key factor in the progression of wet AMD. Unlike traditional corticosteroids, Anecortave does not induce significant anti-inflammatory effects, which reduces the risk of corticosteroid-related side effects such as increased intraocular pressure. Its unique mechanism of action and targeted use make it a promising therapeutic agent in ophthalmology, especially in diseases involving abnormal blood vessel growth.
CAS Number | 7753-60-8 |
Synonyms | 21-(Acetyloxy)-17-hydroxypregna-4,9(11)-diene-3,20-dione; 17,21-Dihydroxypregna-4,9(11)-diene-3,20-dione 21-Acetate; 21-Acetoxypregna-?4,9(11)-dien-17α-ol-3,20-dione; Al 3789; Anecortave Acetate; NSC 15475; NSC 24345; Retaane; |
Molecular Formula | C23H30O5 |
Purity | ≥95% |
Target | PAI-1 |
Storage | Store at +4 ℃ |
IUPAC Name | [2-[(8S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
InChI | InChI=1S/C23H30O5/c1-14(24)28-13-20(26)23(27)11-8-19-17-5-4-15-12-16(25)6-9-21(15,2)18(17)7-10-22(19,23)3/h7,12,17,19,27H,4-6,8-11,13H2,1-3H3/t17-,19+,21+,22+,23+/m1/s1 |
InChIKey | YUWPMEXLKGOSBF-GACAOOTBSA-N |
SMILES | CC(=O)OCC(=O)C1(CCC2C1(CC=C3C2CCC4=CC(=O)CCC43C)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |