For research use only. Not for therapeutic Use.
Anethole（Cat No.:I000251）is a naturally occurring aromatic compound found in essential oils of plants like anise, fennel, and star anise. It is widely used as a flavoring agent due to its sweet, licorice-like taste. Anethole possesses various pharmacological properties, including anti-inflammatory, antimicrobial, and antioxidant effects. It is also studied for its potential anticarcinogenic and estrogenic activities. Beyond its use in the food and beverage industry, anethole is utilized in cosmetics, perfumes, and traditional medicine for treating digestive issues and respiratory ailments, making it a versatile and valuable compound.
| Catalog Number | I000251 |
| CAS Number | 104-46-1 |
| Molecular Formula | C10H12O |
| Purity | ≥95% |
| Solubility | 10mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 1-methoxy-4-[(E)-prop-1-enyl]benzene |
| InChI | InChI=1S/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3/b4-3+ |
| InChIKey | RUVINXPYWBROJD-ONEGZZNKSA-N |
| SMILES | CC=CC1=CC=C(C=C1)OC |
