For research use only. Not for therapeutic Use.
Angelicin (CAT: I003915), also known as psoralen, is a natural furanocoumarin compound found in various plants, such as Psoralea corylifolia and Ammi majus. It exhibits phototoxic and photochemotherapeutic properties. Angelicin is commonly used in combination with ultraviolet A (UVA) radiation in a treatment known as PUVA (psoralen plus UVA therapy) for certain skin disorders, including psoriasis, vitiligo, and cutaneous T-cell lymphoma. When activated by UVA light, angelicin forms covalent crosslinks with DNA, which interferes with DNA replication and inhibits cell proliferation. This mechanism helps to reduce inflammation, promote repigmentation, and suppress abnormal cell growth.
| Catalog Number | I003915 |
| CAS Number | 523-50-2 |
| Synonyms | Bakuchicin;NSC 404563 |
| Molecular Formula | C11H6O3 |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IC50 | 49.56 μM (cellular cytotoxicity); 5.39 μg/ml (28.95 μM) (against MHV-68) |
| IUPAC Name | furo[2,3-h]chromen-2-one |
| InChI | 1S/C11H6O3/c12-10-4-2-7-1-3-9-8(5-6-13-9)11(7)14-10/h1-6H |
| InChIKey | XDROKJSWHURZGO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CO2)C3=C1C=CC(=O)O3 |
