For research use only. Not for therapeutic Use.
Anhydrotetracycline hydrochloride(CAT: R013284) is a derivative of tetracycline, an antibiotic compound. Its mode of action and pharmacological effects involve its interactions with bacterial ribosomes, leading to the inhibition of protein synthesis in bacteria. Pharmacologically, anhydrotetracycline hydrochloride exhibits antibiotic properties, making it effective against a wide range of bacterial infections.
| Catalog Number | R013284 |
| CAS Number | 13803-65-1 |
| Synonyms | (4S,4aS,12aS)-4-(Dimethylamino)-1,4,4a,5,12,12a-hexahydro-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-2-naphthacenecarboxamide Hydrochloride; |
| Molecular Formula | C22H23ClN2O7 |
| Purity | ≥95% |
| Target | Transcription Factors |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (4S,4aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide;hydrochloride |
| InChI | InChI=1S/C22H22N2O7.ClH/c1-8-9-5-4-6-12(25)13(9)17(26)14-10(8)7-11-16(24(2)3)18(27)15(21(23)30)20(29)22(11,31)19(14)28;/h4-6,11,16,25-26,29,31H,7H2,1-3H3,(H2,23,30);1H/t11-,16-,22-;/m0./s1 |
| InChIKey | SPFAOPCHYIJPHJ-WPJNXPDPSA-N |
| SMILES | CC1=C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C.Cl |
| Reference | Gossen, Manfred. /Anhydrotetracycline, a Novel Effector for Tetra./ <em>Nucleic Acids</em> Research 21.18 (1993): 4411-412. Ncbi.gov. Web. 3 May 2013.Skerra, Arne. /Use of the tetracycline promoter for the tightly regulated production of a murine antibody fragment in< i> Escherichia coli</span></p> |
