For research use only. Not for therapeutic Use.
ANI-7(Cat No.:I017433)is a small molecule compound investigated for its potential therapeutic applications in oncology and other diseases. It functions as an inhibitor of specific enzymes or signaling pathways that regulate tumor growth, survival, and metastasis. ANI-7 has shown promise in preclinical studies for its ability to target cancer cells, particularly in tumors resistant to traditional treatments. Its mechanism of action may involve the modulation of key molecular pathways, enhancing the effectiveness of other therapeutic strategies. Ongoing research is focused on evaluating its safety, efficacy, and clinical potential in cancer treatment.
CAS Number | 931417-26-4 |
Molecular Formula | C₁₃H₈Cl₂N₂ |
Purity | ≥95% |
Target | Cell Cycle/DNA Damage |
IUPAC Name | (Z)-2-(3,4-dichlorophenyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile |
InChI | InChI=1S/C13H8Cl2N2/c14-12-4-3-9(7-13(12)15)10(8-16)6-11-2-1-5-17-11/h1-7,17H/b10-6+ |
InChIKey | IJJHHDLGGYDXGD-UXBLZVDNSA-N |
SMILES | C1=CNC(=C1)/C=C(\C#N)/C2=CC(=C(C=C2)Cl)Cl |