Anisaldehyde-13C（Cat No.:R004495） is a high-purity, isotopically labeled compound essential for advanced biochemical and pharmaceutical research. Featuring a carbon-13 atom, this labeled version of Anisaldehyde allows for precise tracking in metabolic and analytical studies. Its stable isotope labeling ensures accurate and reproducible results, making it ideal for use in NMR spectroscopy, mass spectrometry, and other sophisticated analytical techniques. This compound is crucial for researchers focusing on aromatic aldehyde metabolism, flavor and fragrance analysis, and drug development, providing a robust and reliable solution for high-precision scientific investigations.
| Catalog Number | R004495 |
| CAS Number | 95537-93-2 |
| Synonyms | p-Anisaldehyde-13C; 4-Anisaldehyde-13C; 4-Methoxybenzaldehyde-13C; Anisic Aldehyde-13C; Aubepine-13C; Crategine-13C; NSC 5590-13C; Obepin-13C; p-Anisic Aldehyde-13C; p-Formylanisole-13C; p-Methoxybenzaldehyde-13C; ? |
| Molecular Formula | C8H8O2 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-methoxybenzaldehyde |
| InChI | InChI=1S/C8H8O2/c1-10-8-4-2-7(6-9)3-5-8/h2-6H,1H3/i6+1 |
| InChIKey | ZRSNZINYAWTAHE-PTQBSOBMSA-N |
| SMILES | COC1=CC=C(C=C1)[13CH]=O |
