For research use only, not for therapeutic use.
Ankaflavin (Cat.No:I012825) is a natural flavonoid compound found in herbs like Scutellaria baicalensis Georgi. It has been shown to have anti-inflammatory and anti-tumor activities, as well as exhibiting hepatoprotective effects. Ankaflavin has potential therapeutic applications in treating various inflammatory diseases and cancer, as well as in the development of functional foods and nutraceuticals. Its chemical structure contains a flavone backbone with a fused pyrane ring.
| Catalog Number | I012825 |
| CAS Number | 50980-32-0 |
| Synonyms | (3S,3aR,9aR)-9a-methyl-3-octanoyl-6-[(E)-prop-1-enyl]-3,3a,4,8-tetrahydrofuro[3,2-g]isochromene-2,9-dione |
| Molecular Formula | C23H30O5 |
| Purity | ≥95% |
| IUPAC Name | (3S,3aR,9aR)-9a-methyl-3-octanoyl-6-[(E)-prop-1-enyl]-3,3a,4,8-tetrahydrofuro[3,2-g]isochromene-2,9-dione |
| InChI | InChI=1S/C23H30O5/c1-4-6-7-8-9-11-19(24)20-18-13-15-12-16(10-5-2)27-14-17(15)21(25)23(18,3)28-22(20)26/h5,10,12,18,20H,4,6-9,11,13-14H2,1-3H3/b10-5+/t18-,20+,23-/m1/s1 |
| InChIKey | AQTJNEHGKRUSLT-ODTNPMSZSA-N |
| SMILES | CCCCCCCC(=O)[C@@H]1[C@H]2CC3=C(COC(=C3)/C=C/C)C(=O)[C@@]2(OC1=O)C |
