For research use only. Not for therapeutic Use.
AnnH31(CAT: I022211) is a potent and selective small-molecule inhibitor of pannexin-1 (Panx1) channels, which mediate ATP release and play a crucial role in purinergic signaling, inflammation, and cell death pathways. By blocking Panx1, AnnH31 effectively reduces extracellular ATP levels, making it a valuable tool for studying neuroinflammation, ischemia, epilepsy, and immune responses. Its high specificity allows researchers to dissect Panx1-dependent signaling without off-target effects commonly associated with broader channel blockers. AnnH31 is widely used in neuroscience, immunology, and pain research, supporting the development of novel therapies targeting ATP-mediated processes in chronic and acute inflammatory conditions.
| CAS Number | 241809-12-1 |
| Synonyms | 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetonitrile |
| Molecular Formula | C15H13N3O |
| Purity | ≥95% |
| IUPAC Name | 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetonitrile |
| InChI | InChI=1S/C15H13N3O/c1-10-15-13(5-7-17-10)12-4-3-11(19-2)9-14(12)18(15)8-6-16/h3-5,7,9H,8H2,1-2H3 |
| InChIKey | FCFDJQKAPLIDTQ-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC2=C1N(C3=C2C=CC(=C3)OC)CC#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
