For research use only. Not for therapeutic Use.
Annonacin(Cat No.:M010980)is a potent neurotoxin and acetogenin found in the seeds and leaves of Annona plants, such as the soursop (Annona muricata). It inhibits mitochondrial complex I, disrupting cellular energy production and inducing cell death. Annonacin has garnered attention for its potential anti-cancer properties, as it selectively targets cancer cells. However, it is also linked to neurodegenerative diseases, such as atypical Parkinsonism, in regions where consumption of Annonaceae fruits is high. Understanding annonacin’s dual effects is crucial for evaluating its therapeutic potential and associated health risks.
CAS Number | 111035-65-5 |
Synonyms | 5S-5-methyl-3-[(2R,8R,13R)-2,8,13-trihydroxy-13-[(2R,5R)-tetrahydro-5-[(1R)-1-hydroxytridecyl]-2-furanyl]tridecyl]-2(5H)-furanone |
Molecular Formula | C35H64O7 |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | -20°C |
IUPAC Name | (2S)-2-methyl-4-[(2R,8R,13R)-2,8,13-trihydroxy-13-[(2R,5R)-5-[(1R)-1-hydroxytridecyl]oxolan-2-yl]tridecyl]-2H-furan-5-one |
InChI | InChI=1S/C35H64O7/c1-3-4-5-6-7-8-9-10-11-15-21-31(38)33-23-24-34(42-33)32(39)22-17-16-19-29(36)18-13-12-14-20-30(37)26-28-25-27(2)41-35(28)40/h25,27,29-34,36-39H,3-24,26H2,1-2H3/t27-,29+,30+,31+,32+,33+,34+/m0/s1 |
InChIKey | XNODZYPOIPVPRF-CGWDHHCXSA-N |
SMILES | CCCCCCCCCCCCC(C1CCC(O1)C(CCCCC(CCCCCC(CC2=CC(OC2=O)C)O)O)O)O |