For research use only. Not for therapeutic Use.
Ansamitocin P-3 (Cat.No:I004500), also known as ansamitocin-Δ2,3-3′-methyl ester, is a potent antitumor antibiotic produced by the Actinosynnema pretiosum bacteria. It is a macrocyclic lactam that inhibits microtubule assembly and promotes their depolymerization. Ansamitocin P-3 has shown strong activity against various types of cancer cells and is being studied as a potential chemotherapy drug.
| Catalog Number | I004500 |
| CAS Number | 66547-09-9 |
| Synonyms | Antibiotic C-15003P3;Maytansinol butyrate |
| Molecular Formula | C32H43ClN2O9 |
| Purity | ≥95% |
| Target | microtubule inhibitor |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | [(1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] butanoate |
| InChI | InChI=1S/C32H43ClN2O9/c1-17(2)29(37)43-25-15-26(36)35(6)21-13-20(14-22(40-7)27(21)33)12-18(3)10-9-11-24(41-8)32(39)16-23(42-30(38)34-32)19(4)28-31(25,5)44-28/h9-11,13-14,17,19,23-25,28,39H,12,15-16H2,1-8H3,(H,34,38)/b11-9+,18-10+/t19-,23+,24-,25+,28+,31+, |
| InChIKey | WLKHTIAFMSHJLG-BYXOJEECSA-N |
| SMILES | C[C@@]1([C@@H](O1)[C@H](C)[C@]([H])(C[C@](N2)(O)[C@]([H])(OC)/C=C/C=C(CC3=CC(OC)=C(Cl)C4=C3)C)OC2=O)[C@@]([H])(OC(CCC)=O)CC(N4C)=O |
| Reference | <p style=/line-height:25px/> </p> |
