For research use only. Not for therapeutic Use.
Anserine（Cat No.:I019857）, is a naturally occurring dipeptide found in various animal tissues, especially in skeletal muscles and certain fish. Comprising beta-alanine and histidine, anserine plays a role in cellular energy metabolism and acts as a buffer against pH changes during intense physical activity. It is considered a nutritional compound and is often included in dietary supplements targeted at enhancing exercise performance and muscle health. Anserine’s potential benefits in improving muscle function and reducing oxidative stress have led to its exploration in the context of sports nutrition and overall well-being.
| Catalog Number | I019857 |
| CAS Number | 584-85-0 |
| Molecular Formula | C₁₀H₁₆N₄O₃ |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | 2-8°C(protect from light) |
| IUPAC Name | (2S)-2-(3-aminopropanoylamino)-3-(3-methylimidazol-4-yl)propanoic acid |
| InChI | InChI=1S/C10H16N4O3/c1-14-6-12-5-7(14)4-8(10(16)17)13-9(15)2-3-11/h5-6,8H,2-4,11H2,1H3,(H,13,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | MYYIAHXIVFADCU-QMMMGPOBSA-N |
| SMILES | CN1C=NC=C1CC(C(=O)O)NC(=O)CCN |
| Reference | [1]. Boldyrev AA, et al. The histidine-containing dipeptides, carnosine and anserine: distribution, properties and biological significance. Adv Enzyme Regul. 1990;30:175-94.<br>[2]. Jun Kaneko, et al. Anserine (beta-alanyl-3-methyl-L-histidine) improves neurovascular-unit dysfunction and spatial memory in aged AβPPswe/PSEN1dE9 Alzheimer’s-model mice. Sci Rep. 2017 Oct 3;7(1):12571. |
