For research use only. Not for therapeutic Use.
Anthracene-13C6（Cat No.:R010617） is a high-purity deuterated compound featuring six carbon-13 atoms, essential for advanced research in organic chemistry, environmental science, and materials science. This isotopically labeled version of anthracene is crucial for studies involving reaction mechanisms, molecular interactions, and environmental tracing. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the robustness of experimental data. Ideal for use in NMR spectroscopy, mass spectrometry, and tracer studies, Anthracene-13C6 integrates seamlessly into existing protocols, offering a dependable and cost-effective solution for high-precision scientific investigations in various research fields.
| Catalog Number | R010617 |
| CAS Number | 189811-60-7 |
| Synonyms | Anthracin-13C6; Green Oil-13C6; NSC 7958-13C6; Paranaphthalene-13C6; Tetra Olive N2G-13C6; |
| Molecular Formula | C14H10 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | anthracene |
| InChI | InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H/i1+1,2+1,5+1,6+1,11+1,12+1 |
| InChIKey | MWPLVEDNUUSJAV-LSMJWXKXSA-N |
| SMILES | C1=CC2=C[13C]3=[13CH][13CH]=[13CH][13CH]=[13C]3C=C2C=C1 |
