For research use only. Not for therapeutic Use.
Anthracene-9,10-dithiol(CAT: M209694) is an organic compound derived from anthracene, featuring two thiol (–SH) groups at the 9 and 10 positions of the anthracene ring. This dithiol functionality enhances its chemical reactivity and allows it to form strong interactions with metal surfaces, particularly in the formation of self-assembled monolayers (SAMs) on gold and other conductive materials. Such properties make Anthracene-9,10-dithiol valuable in materials science, especially in the development of molecular electronics, organic photovoltaics, and sensing devices. Its conjugated aromatic structure also contributes to unique optical and electronic characteristics, making it useful for researchers studying conductive organic materials and light-responsive compounds.
CAS Number | 86756-29-8 |
Molecular Formula | C14H10S2 |
Purity | ≥95% |
IUPAC Name | anthracene-9,10-dithiol |
InChI | InChI=1S/C14H10S2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8,15-16H |
InChIKey | QHWTVIYSEHVEKU-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2S)S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |