For research use only. Not for therapeutic Use.
Anthracene is a polycyclic aromatic hydrocarbon (PAH) composed of three fused benzene rings, commonly used in organic chemistry and material science. It serves as a precursor in the production of dyes, and in the synthesis of anthraquinone, an important compound in the dye industry. Due to its luminescent properties, anthracene is also utilized in scintillation counters for detecting ionizing radiation. Additionally, it plays a role in the study of photochemical reactions and is used in organic semiconductor research for developing electronic devices.
| Catalog Number | R009366 |
| CAS Number | 120-12-7 |
| Synonyms | Anthracin; Green Oil; NSC 7958; Paranaphthalene; Tetra Olive N2G; |
| Molecular Formula | C14H10 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | anthracene |
| InChI | InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H |
| InChIKey | MWPLVEDNUUSJAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C=CC=CC3=CC2=C1 |
