For research use only. Not for therapeutic Use.
Anthraquinone-D8 (Cat No.: R060357) is a high-purity, deuterium-labeled derivative of anthraquinone, essential for advanced chemical and biochemical research. This compound, featuring eight deuterium atoms, is crucial for studying reaction mechanisms, photochemical properties, and environmental fate. Its stable isotope labeling ensures precise and reliable results in mass spectrometry and NMR spectroscopy. Ideal for cutting-edge research in organic synthesis, dye production, and environmental science, Anthraquinone-D8 enhances the accuracy of experimental data, supporting advancements in scientific investigations and analytical applications.
CAS Number | 10439-39-1 |
Synonyms | 9,10-Anthracenedione-1,2,3,4,5,6,7,8-D8; 9,10-Anthraquinone-D8 |
Molecular Formula | C14H8O2 |
Purity | ≥95% |
Target | Virus Protease |
Storage | Store at RT |
IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterioanthracene-9,10-dione |
InChI | InChI=1S/C14H8O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
InChIKey | RZVHIXYEVGDQDX-PGRXLJNUSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3C2=O |