For research use only. Not for therapeutic Use.
Anthrarufin(Cat No.:R052037), is a chemical compound classified as a member of the anthraquinone family. It is a natural dye found in certain plant sources, such as madder roots. Anthrarufin has been historically used as a red dye for textiles and various materials due to its vibrant color properties. Additionally, it has exhibited potential medicinal properties, with studies indicating antioxidant and anti-inflammatory effects. Its structure and properties have made it an object of interest in both the fields of natural colorants and pharmacological research, shedding light on its historical and potential future applications.
Catalog Number | R052037 |
CAS Number | 117-12-4 |
Synonyms | 1,5-Dihydroxyanthraquinone; 1,5-Dihydroxy-9,10-anthraquinone; NSC 646570; NSC 7211; |
Molecular Formula | C14H8O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,5-dihydroxyanthracene-9,10-dione |
InChI | InChI=1S/C14H8O4/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6,15-16H |
InChIKey | JPICKYUTICNNNJ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C(=CC=C3)O |