For research use only. Not for therapeutic Use.
Antibiofilm agent-1 (Cat No.: I040174) is a compound designed to prevent or disrupt biofilm formation, which is a protective layer produced by bacteria to shield themselves from antibiotics and the immune system. It works by interfering with the bacterial mechanisms responsible for biofilm development, making bacteria more susceptible to treatment. This agent is often studied for its potential use in clinical settings to combat chronic infections associated with biofilm-forming pathogens, such as in medical device-related infections or chronic wound healing, improving therapeutic outcomes.
| CAS Number | 2001602-10-2 |
| Synonyms | (4,5-dibromo-1H-pyrrol-2-yl)-(3,5-dichloro-2-hydroxyphenyl)methanone |
| Molecular Formula | C11H5Br2Cl2NO2 |
| Purity | ≥95% |
| InChI | InChI=1S/C11H5Br2Cl2NO2/c12-6-3-8(16-11(6)13)10(18)5-1-4(14)2-7(15)9(5)17/h1-3,16-17H |
| InChIKey | IJADFNLHNSFJDN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)C2=CC(=C(N2)Br)Br)O)Cl)Cl |
| Reference | [1]. Rongshi Li, et al. Pyrrolomycines et leurs procédés d’utilisation. WO2017011725A1. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
