For research use only. Not for therapeutic Use.
Anticancer agent 43（Cat No.:I043833）is a novel small molecule compound designed to target and inhibit specific proteins involved in cancer cell growth and survival. It works by disrupting critical signaling pathways, leading to the inhibition of tumor proliferation and inducing cell death in cancer cells. Preclinical studies have shown that Anticancer agent 43 effectively targets various types of cancer, including breast, lung, and colon cancer. Its selective action helps reduce toxicity to normal cells, making it a promising candidate for further development as a targeted therapy in cancer treatment.
| CAS Number | 2470015-35-9 |
| Synonyms | methyl (3E)-5-fluoro-3-[(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylidene]indole-2-carboxylate |
| Molecular Formula | C14H9FN2O3S2 |
| Purity | ≥95% |
| IUPAC Name | methyl (3E)-5-fluoro-3-[(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylidene]indole-2-carboxylate |
| InChI | InChI=1S/C14H9FN2O3S2/c1-20-13(19)11-8(5-10-12(18)17-14(21)22-10)7-4-6(15)2-3-9(7)16-11/h2-5,18H,1H3,(H,17,21)/b8-5+ |
| InChIKey | GBWAVAUPOYYLNO-VMPITWQZSA-N |
| SMILES | COC(=O)C\1=NC2=C(/C1=C\C3=C(NC(=S)S3)O)C=C(C=C2)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
