For research use only. Not for therapeutic Use.
Anticancer agent 73（Cat No.:I043498）is an investigational compound being studied for its potential in cancer treatment. It is designed to target specific molecular pathways involved in tumor growth, cell proliferation, and metastasis. The compound may work by inhibiting key enzymes or receptors that promote cancer cell survival, ultimately leading to tumor cell death. Research is ongoing to evaluate its effectiveness, safety, and potential applications in various types of cancer, including solid tumors and hematological malignancies. Anticancer agent 73 may offer a promising therapeutic alternative to current cancer treatments, particularly for resistant or advanced cancers.
| CAS Number | 124811-87-6 |
| Synonyms | ethyl 2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylate |
| Molecular Formula | C14H15NO4 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylate |
| InChI | InChI=1S/C14H15NO4/c1-4-18-14(16)12-9(2)19-13(15-12)10-5-7-11(17-3)8-6-10/h5-8H,4H2,1-3H3 |
| InChIKey | DAFRLXQGMZPMLA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=N1)C2=CC=C(C=C2)OC)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
