For research use only. Not for therapeutic Use.
Anticancer Agent 93 (Cat No.:I042288) is a synthetic compound being investigated for its potential to inhibit cancer cell growth. It works by targeting specific molecular pathways involved in tumor development, such as disrupting cell cycle regulation and inducing apoptosis (programmed cell death). Preclinical studies have shown that AG-93 can effectively target various cancer types, including breast, lung, and colorectal cancers. The agent demonstrates the potential to overcome resistance to traditional therapies and reduce side effects, making it a promising candidate for future cancer treatments pending further clinical evaluation.
| Catalog Number | I042288 |
| CAS Number | 94205-22-8 |
| Synonyms | 3-chloro-N-(4-hydroxy-2-oxochromen-3-yl)benzamide |
| Molecular Formula | C16H10ClNO4 |
| Purity | ≥95% |
| IUPAC Name | 3-chloro-N-(4-hydroxy-2-oxochromen-3-yl)benzamide |
| InChI | InChI=1S/C16H10ClNO4/c17-10-5-3-4-9(8-10)15(20)18-13-14(19)11-6-1-2-7-12(11)22-16(13)21/h1-8,19H,(H,18,20) |
| InChIKey | OLUXHDREXNYHFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=O)O2)NC(=O)C3=CC(=CC=C3)Cl)O |
