For research use only. Not for therapeutic Use.
Antifungal agent 49(Cat No.:I041087)is a novel compound developed to target and inhibit the growth of fungal pathogens. It works by interfering with key cellular processes in fungi, such as cell wall synthesis, membrane integrity, and enzyme activity, ultimately leading to fungal cell death. This agent shows broad-spectrum activity against various fungal infections, including those caused by Candida, Aspergillus, and dermatophytes. Antifungal agent 49 has demonstrated promising results in preclinical studies, offering potential as a therapeutic option for treating both superficial and systemic fungal infections, particularly in immunocompromised individuals.
CAS Number | 1414861-21-4 |
Synonyms | 5-benzoyl-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one |
Molecular Formula | C15H12O4 |
Purity | ≥95% |
IUPAC Name | 5-benzoyl-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one |
InChI | InChI=1S/C15H12O4/c1-9-7-12(16)15(19)13(17)8-11(9)14(18)10-5-3-2-4-6-10/h2-8H,1H3,(H2,16,17,19) |
InChIKey | LBEOUJODZMOAIF-UHFFFAOYSA-N |
SMILES | CC1=CC(=O)C(=C(C=C1C(=O)C2=CC=CC=C2)O)O |