For research use only. Not for therapeutic Use.
Antioxidant 1135(Cat No.:M110050)is a high-performance stabilizer commonly used in polymers and lubricants to prevent oxidative degradation. Its chemical structure, featuring hindered phenolic groups, provides excellent thermal stability and long-term protection against heat and light-induced aging. This antioxidant is particularly effective in polyolefins, polyesters, and synthetic rubbers, extending the lifespan and durability of materials. Additionally, Antioxidant 1135 enhances the performance of industrial lubricants, hydraulic fluids, and greases, ensuring optimal functionality under extreme conditions. Its versatility and efficiency make it a crucial additive in maintaining the integrity of various products in demanding applications.
CAS Number | 125643-61-0 |
Synonyms | 3,5-bis(1,1-dimethylethyl)-4-hydroxy-benzenepropanoicacic7_9-branchedalk; 3,5-bis(1,1-dimethylethyl)-4-hydroxy-benzenepropanoicacic7_9-branchedalkylesters; ylesters; octyl-3,5-di-tert-butyl-4-hydroxy-hydrocinnamate; IRGANOX 1135; Evernox 1135 |
Molecular Formula | C25H42O3 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | octyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
InChI | InChI=1S/C25H42O3/c1-8-9-10-11-12-13-16-28-22(26)15-14-19-17-20(24(2,3)4)23(27)21(18-19)25(5,6)7/h17-18,27H,8-16H2,1-7H3 |
InChIKey | CFXCGWWYIDZIMU-UHFFFAOYSA-N |
SMILES | CCCCCCCCOC(=O)CCC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |