For research use only. Not for therapeutic Use.
Antioxidant agent-4（Cat No.:I043238）, also known as 7-methoxybenzo[d][1,3]dioxol-5-ol, is a potent antioxidant compound with notable antilipid peroxidative properties. Its molecular formula is C8H8O4, corresponding to a molecular weight of 168.15 g/mol. The compound features a methoxy group and a dioxolane ring fused to a benzene ring, contributing to its antioxidant activity. Antioxidant agent-4 is utilized in research settings to study oxidative stress mechanisms and to develop therapeutic agents targeting diseases associated with lipid peroxidation and oxidative damage.
| CAS Number | 50901-34-3 |
| Synonyms | 7-methoxy-1,3-benzodioxol-5-ol |
| Molecular Formula | C8H8O4 |
| Purity | ≥95% |
| IUPAC Name | 7-methoxy-1,3-benzodioxol-5-ol |
| InChI | InChI=1S/C8H8O4/c1-10-6-2-5(9)3-7-8(6)12-4-11-7/h2-3,9H,4H2,1H3 |
| InChIKey | HKTCSLUVTXNZKH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1OCO2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
