For research use only. Not for therapeutic Use.
Antiproliferative Agent-13(Cat No.:I042950)is a promising compound designed to inhibit the proliferation of cancer cells by targeting key molecular pathways involved in cell cycle regulation and tumor growth. It works by interfering with critical proteins or enzymes that regulate cell division, leading to cell cycle arrest and apoptosis in rapidly dividing cancer cells. Antiproliferative Agent-13 has demonstrated potential in preclinical studies, showing effectiveness against various cancer types, including drug-resistant tumors. Ongoing research is focused on exploring its mechanism of action, safety, and therapeutic potential as a novel cancer treatment option.
CAS Number | 663214-48-0 |
Synonyms | 6-amino-8-(3,4,5-trimethoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile |
Molecular Formula | C20H18N2O6 |
Purity | ≥95% |
IUPAC Name | 6-amino-8-(3,4,5-trimethoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile |
InChI | InChI=1S/C20H18N2O6/c1-23-16-4-10(5-17(24-2)19(16)25-3)18-11-6-14-15(27-9-26-14)7-13(11)28-20(22)12(18)8-21/h4-7,18H,9,22H2,1-3H3 |
InChIKey | LLTPNRJVRNURSX-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC(=C1OC)OC)C2C3=CC4=C(C=C3OC(=C2C#N)N)OCO4 |