For research use only. Not for therapeutic Use.
Antiproliferative Agent-14(Cat No.:I042636)is a novel compound designed to inhibit the proliferation of cancer cells by targeting key molecular pathways involved in cell growth and division. It works by disrupting critical signaling pathways, such as those controlling the cell cycle or apoptosis, leading to cell cycle arrest and induction of programmed cell death in malignant cells. Antiproliferative Agent-14 has shown efficacy against various cancer types, including those resistant to traditional therapies. Ongoing research aims to explore its mechanism of action, safety, and potential for use as an adjunct in cancer treatment.
CAS Number | 1885900-35-5 |
Synonyms | 2-[6-fluoro-3-[(4-methoxyphenyl)methylamino]imidazo[1,2-a]pyridin-2-yl]phenol |
Molecular Formula | C21H18FN3O2 |
Purity | ≥95% |
IUPAC Name | 2-[6-fluoro-3-[(4-methoxyphenyl)methylamino]imidazo[1,2-a]pyridin-2-yl]phenol |
InChI | InChI=1S/C21H18FN3O2/c1-27-16-9-6-14(7-10-16)12-23-21-20(17-4-2-3-5-18(17)26)24-19-11-8-15(22)13-25(19)21/h2-11,13,23,26H,12H2,1H3 |
InChIKey | QBNMSKFVSPKNSV-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)CNC2=C(N=C3N2C=C(C=C3)F)C4=CC=CC=C4O |