For research use only. Not for therapeutic Use.
Antiviral agent 17（Cat No.:I043694）is a novel compound designed to target and inhibit the replication of viruses by interfering with key stages of the viral life cycle. It works by blocking viral entry into host cells, disrupting viral replication, or inhibiting essential enzymes involved in viral assembly. Preclinical studies have shown promising activity against a range of viruses, including influenza, HIV, and hepatitis. Antiviral agent 17’s mechanism of action offers a targeted approach to combat viral infections, making it a potential therapeutic option in the treatment of both acute and chronic viral diseases.
| CAS Number | 158227-81-7 |
| Synonyms | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| Molecular Formula | C11H14N4O4 |
| Purity | ≥95% |
| IUPAC Name | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChI | InChI=1S/C11H14N4O4/c12-11-6-2-1-5(15(6)14-4-13-11)10-9(18)8(17)7(3-16)19-10/h1-2,4,7-10,16-18H,3H2,(H2,12,13,14)/t7-,8-,9-,10+/m1/s1 |
| InChIKey | IGZFWIAREXANMY-KYXWUPHJSA-N |
| SMILES | C1=C(N2C(=C1)C(=NC=N2)N)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
